C21H32O6P+ — CID 162258784
2-methoxyethyl 2-cyclohexyl-3-oxo-3-(2,4,6-trimethylphenyl)propaneperoxoate;oxophosphanium (PubChem CID 162258784) has the molecular formula C21H32O6P+ and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-methoxyethyl 2-cyclohexyl-3-oxo-3-(2,4,6-trimethylphenyl)propaneperoxoate;oxophosphanium.
| Compound Name | 2-methoxyethyl 2-cyclohexyl-3-oxo-3-(2,4,6-trimethylphenyl)propaneperoxoate;oxophosphanium |
|---|---|
| PubChem CID | 162258784 |
| Molecular Formula | C21H32O6P+ |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 2-methoxyethyl 2-cyclohexyl-3-oxo-3-(2,4,6-trimethylphenyl)propaneperoxoate;oxophosphanium |
| SMILES | COCCOOC(=O)C(C(=O)c1c(C)cc(C)cc1C)C1CCCCC1.O=[PH2+] |
| InChI | InChI=1S/C21H30O5.H2OP/c1-14-12-15(2)18(16(3)13-14)20(22)19(17-8-6-5-7-9-17)21(23)26-25-11-10-24-4;1-2/h12-13,17,19H,5-11H2,1-4H3;2H2/q;+1 |
| InChIKey | XNXQKJZVZRPXKL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|