C22H33O4P — CID 174387844
2-methylpropyl 2-[cyclohexyl-(2,4,6-trimethylbenzoyl)phosphoryl]acetate (PubChem CID 174387844) has the molecular formula C22H33O4P and a molecular weight of 392.48 g/mol. Its IUPAC name is 2-methylpropyl 2-[cyclohexyl-(2,4,6-trimethylbenzoyl)phosphoryl]acetate.
| Compound Name | 2-methylpropyl 2-[cyclohexyl-(2,4,6-trimethylbenzoyl)phosphoryl]acetate |
|---|---|
| PubChem CID | 174387844 |
| Molecular Formula | C22H33O4P |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 2-methylpropyl 2-[cyclohexyl-(2,4,6-trimethylbenzoyl)phosphoryl]acetate |
| SMILES | Cc1cc(C)c(C(=O)P(=O)(CC(=O)OCC(C)C)C2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C22H33O4P/c1-15(2)13-26-20(23)14-27(25,19-9-7-6-8-10-19)22(24)21-17(4)11-16(3)12-18(21)5/h11-12,15,19H,6-10,13-14H2,1-5H3 |
| InChIKey | IJRMCJAZVSKLAA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|