C27H35O5P — CID 59218791
[2-(oxan-2-yloxy)ethyl-(2,4,6-trimethylbenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 59218791) has the molecular formula C27H35O5P and a molecular weight of 470.55 g/mol. Its IUPAC name is [2-(oxan-2-yloxy)ethyl-(2,4,6-trimethylbenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [2-(oxan-2-yloxy)ethyl-(2,4,6-trimethylbenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 59218791 |
| Molecular Formula | C27H35O5P |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | [2-(oxan-2-yloxy)ethyl-(2,4,6-trimethylbenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)P(=O)(CCOC2CCCCO2)C(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C27H35O5P/c1-17-13-19(3)24(20(4)14-17)26(28)33(30,12-11-32-23-9-7-8-10-31-23)27(29)25-21(5)15-18(2)16-22(25)6/h13-16,23H,7-12H2,1-6H3 |
| InChIKey | KQSHQDKAJFAQBC-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|