C11H15NO4 — CID 86339553
1-[5-[[(2S)-oxan-2-yl]oxymethyl]-1,2-oxazol-3-yl]ethanone (PubChem CID 86339553) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is 1-[5-[[(2S)-oxan-2-yl]oxymethyl]-1,2-oxazol-3-yl]ethanone.
| Compound Name | 1-[5-[[(2S)-oxan-2-yl]oxymethyl]-1,2-oxazol-3-yl]ethanone |
|---|---|
| PubChem CID | 86339553 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 1-[5-[[(2S)-oxan-2-yl]oxymethyl]-1,2-oxazol-3-yl]ethanone |
| SMILES | CC(=O)c1cc(CO[C@H]2CCCCO2)on1 |
| InChI | InChI=1S/C11H15NO4/c1-8(13)10-6-9(16-12-10)7-15-11-4-2-3-5-14-11/h6,11H,2-5,7H2,1H3/t11-/m0/s1 |
| InChIKey | TWIBRARCEKPWRR-NSHDSACASA-N |
| XLogP | 1.92 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |