C14H23NO3 — CID 66952939
3-(oxan-2-yloxymethyl)-5-pentyl-1,2-oxazole (PubChem CID 66952939) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 3-(oxan-2-yloxymethyl)-5-pentyl-1,2-oxazole.
| Compound Name | 3-(oxan-2-yloxymethyl)-5-pentyl-1,2-oxazole |
|---|---|
| PubChem CID | 66952939 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 3-(oxan-2-yloxymethyl)-5-pentyl-1,2-oxazole |
| SMILES | CCCCCc1cc(COC2CCCCO2)no1 |
| InChI | InChI=1S/C14H23NO3/c1-2-3-4-7-13-10-12(15-18-13)11-17-14-8-5-6-9-16-14/h10,14H,2-9,11H2,1H3 |
| InChIKey | BHBZXHPDSIXERZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|