3-[3-(oxan-2-yloxymethyl)-1,2-oxazol-5-yl]benzoic acid

C16H17NO5 — CID 18548803

IUPAC3-[3-(oxan-2-yloxymethyl)-1,2-oxazol-5-yl]benzoic acid
SMILESO=C(O)c1cccc(-c2cc(COC3CCCCO3)no2)c1
InChIInChI=1S/C16H17NO5/c18-16(19)12-5-3-4-11(8-12)14-9-13(17-22-14)10-21-15-6-1-2-7-20-15/h3-5,8-9,15H,1-2,6-7,10H2,(H,18,19)
InChIKeyQKAQKHWPUIFCFS-UHFFFAOYSA-N
MW303.31 g/mol
LogP3.08
Rot. Bonds5

About 3-[3-(oxan-2-yloxymethyl)-1,2-oxazol-5-yl]benzoic acid

3-[3-(oxan-2-yloxymethyl)-1,2-oxazol-5-yl]benzoic acid (PubChem CID 18548803) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is 3-[3-(oxan-2-yloxymethyl)-1,2-oxazol-5-yl]benzoic acid.

Molecular Properties

Compound Name3-[3-(oxan-2-yloxymethyl)-1,2-oxazol-5-yl]benzoic acid
PubChem CID18548803
Molecular FormulaC16H17NO5
Molecular Weight303.31 g/mol
Exact Mass303.11
IUPAC Name3-[3-(oxan-2-yloxymethyl)-1,2-oxazol-5-yl]benzoic acid
SMILESO=C(O)c1cccc(-c2cc(COC3CCCCO3)no2)c1
InChIInChI=1S/C16H17NO5/c18-16(19)12-5-3-4-11(8-12)14-9-13(17-22-14)10-21-15-6-1-2-7-20-15/h3-5,8-9,15H,1-2,6-7,10H2,(H,18,19)
InChIKeyQKAQKHWPUIFCFS-UHFFFAOYSA-N
XLogP3.08
TPSA81.79 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.31
LogP ≤ 53.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 3-[3-(oxan-2-yloxymethyl)-1,2-oxazol-5-yl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[3-(oxan-2-yloxymethyl)-1,2-oxazol-5-yl]benzoic acid?
The IUPAC name of 3-[3-(oxan-2-yloxymethyl)-1,2-oxazol-5-yl]benzoic acid (CID 18548803) is 3-[3-(oxan-2-yloxymethyl)-1,2-oxazol-5-yl]benzoic acid.
What is the SMILES notation for 3-[3-(oxan-2-yloxymethyl)-1,2-oxazol-5-yl]benzoic acid?
The canonical SMILES for 3-[3-(oxan-2-yloxymethyl)-1,2-oxazol-5-yl]benzoic acid is O=C(O)c1cccc(-c2cc(COC3CCCCO3)no2)c1.
What is the InChIKey of 3-[3-(oxan-2-yloxymethyl)-1,2-oxazol-5-yl]benzoic acid?
The InChIKey is QKAQKHWPUIFCFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO5/c18-16(19)12-5-3-4-11(8-12)14-9-13(17-22-14)10-21-15-6-1-2-7-20-15/h3-5,8-9,15H,1-2,6-7,10H2,(H,18,19).
What are the key properties of 3-[3-(oxan-2-yloxymethyl)-1,2-oxazol-5-yl]benzoic acid?
3-[3-(oxan-2-yloxymethyl)-1,2-oxazol-5-yl]benzoic acid has a molecular weight of 303.31 g/mol, XLogP of 3.08, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(oxan-2-yloxymethyl)-1,2-oxazol-5-yl]benzoic acid is sourced from PubChem (CID 18548803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).