C17H19NO4S — CID 18613074
3-[2-methyl-5-(oxan-2-yloxymethyl)-1,3-thiazol-4-yl]benzoic acid (PubChem CID 18613074) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is 3-[2-methyl-5-(oxan-2-yloxymethyl)-1,3-thiazol-4-yl]benzoic acid.
| Compound Name | 3-[2-methyl-5-(oxan-2-yloxymethyl)-1,3-thiazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 18613074 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 3-[2-methyl-5-(oxan-2-yloxymethyl)-1,3-thiazol-4-yl]benzoic acid |
| SMILES | Cc1nc(-c2cccc(C(=O)O)c2)c(COC2CCCCO2)s1 |
| InChI | InChI=1S/C17H19NO4S/c1-11-18-16(12-5-4-6-13(9-12)17(19)20)14(23-11)10-22-15-7-2-3-8-21-15/h4-6,9,15H,2-3,7-8,10H2,1H3,(H,19,20) |
| InChIKey | PUBZOTIZKBWGHZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |