C10H17N3O2 — CID 124673951
1-methyl-5-[[(2R)-oxan-2-yl]oxymethyl]pyrazol-3-amine (PubChem CID 124673951) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 1-methyl-5-[[(2R)-oxan-2-yl]oxymethyl]pyrazol-3-amine.
| Compound Name | 1-methyl-5-[[(2R)-oxan-2-yl]oxymethyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 124673951 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 1-methyl-5-[[(2R)-oxan-2-yl]oxymethyl]pyrazol-3-amine |
| SMILES | Cn1nc(N)cc1CO[C@@H]1CCCCO1 |
| InChI | InChI=1S/C10H17N3O2/c1-13-8(6-9(11)12-13)7-15-10-4-2-3-5-14-10/h6,10H,2-5,7H2,1H3,(H2,11,12)/t10-/m1/s1 |
| InChIKey | LGJVQTYRJMIUTE-SNVBAGLBSA-N |
| XLogP | 1.05 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |