C9H15N3O2 — CID 90166122
5-(oxan-2-yloxymethyl)-1H-pyrazol-3-amine (PubChem CID 90166122) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 5-(oxan-2-yloxymethyl)-1H-pyrazol-3-amine.
| Compound Name | 5-(oxan-2-yloxymethyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 90166122 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 5-(oxan-2-yloxymethyl)-1H-pyrazol-3-amine |
| SMILES | Nc1cc(COC2CCCCO2)[nH]n1 |
| InChI | InChI=1S/C9H15N3O2/c10-8-5-7(11-12-8)6-14-9-3-1-2-4-13-9/h5,9H,1-4,6H2,(H3,10,11,12) |
| InChIKey | SXGMHWODTSDJCD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |