C17H26N2O4 — CID 167497349
[3-[4-(oxan-2-yloxymethyl)-2-oxabicyclo[2.2.2]octan-1-yl]-1H-pyrazol-5-yl]methanol (PubChem CID 167497349) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is [3-[4-(oxan-2-yloxymethyl)-2-oxabicyclo[2.2.2]octan-1-yl]-1H-pyrazol-5-yl]methanol.
| Compound Name | [3-[4-(oxan-2-yloxymethyl)-2-oxabicyclo[2.2.2]octan-1-yl]-1H-pyrazol-5-yl]methanol |
|---|---|
| PubChem CID | 167497349 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | [3-[4-(oxan-2-yloxymethyl)-2-oxabicyclo[2.2.2]octan-1-yl]-1H-pyrazol-5-yl]methanol |
| SMILES | OCc1cc(C23CCC(COC4CCCCO4)(CC2)CO3)n[nH]1 |
| InChI | InChI=1S/C17H26N2O4/c20-10-13-9-14(19-18-13)17-6-4-16(5-7-17,12-23-17)11-22-15-3-1-2-8-21-15/h9,15,20H,1-8,10-12H2,(H,18,19) |
| InChIKey | SDHMKRGKBVFKHU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 76.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |