C22H30N4O2 — CID 167497480
(7S)-7-methyl-11-[4-(oxan-2-yloxymethyl)-1-bicyclo[2.2.1]heptanyl]-4,6,9,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene (PubChem CID 167497480) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is (7S)-7-methyl-11-[4-(oxan-2-yloxymethyl)-1-bicyclo[2.2.1]heptanyl]-4,6,9,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene.
| Compound Name | (7S)-7-methyl-11-[4-(oxan-2-yloxymethyl)-1-bicyclo[2.2.1]heptanyl]-4,6,9,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene |
|---|---|
| PubChem CID | 167497480 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | (7S)-7-methyl-11-[4-(oxan-2-yloxymethyl)-1-bicyclo[2.2.1]heptanyl]-4,6,9,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene |
| SMILES | C[C@H]1Cn2nc(C34CCC(COC5CCCCO5)(CC3)C4)cc2-c2cncn21 |
| InChI | InChI=1S/C22H30N4O2/c1-16-12-26-17(18-11-23-15-25(16)18)10-19(24-26)22-7-5-21(13-22,6-8-22)14-28-20-4-2-3-9-27-20/h10-11,15-16,20H,2-9,12-14H2,1H3/t16-,20?,21?,22?/m0/s1 |
| InChIKey | GCHLGNIPHNNQCT-XQDFYDKTSA-N |
| XLogP | 4.07 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |