C17H29BN2O4 — CID 151692200
1,5-dimethyl-3-(oxan-2-yloxymethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 151692200) has the molecular formula C17H29BN2O4 and a molecular weight of 336.24 g/mol. Its IUPAC name is 1,5-dimethyl-3-(oxan-2-yloxymethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 1,5-dimethyl-3-(oxan-2-yloxymethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 151692200 |
| Molecular Formula | C17H29BN2O4 |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 1,5-dimethyl-3-(oxan-2-yloxymethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | Cc1c(B2OC(C)(C)C(C)(C)O2)c(COC2CCCCO2)nn1C |
| InChI | InChI=1S/C17H29BN2O4/c1-12-15(18-23-16(2,3)17(4,5)24-18)13(19-20(12)6)11-22-14-9-7-8-10-21-14/h14H,7-11H2,1-6H3 |
| InChIKey | RCURHKGUONBGAR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|