C18H29BN2O4S — CID 155776024
2-(oxan-2-yloxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]thiazine (PubChem CID 155776024) has the molecular formula C18H29BN2O4S and a molecular weight of 380.32 g/mol. Its IUPAC name is 2-(oxan-2-yloxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]thiazine.
| Compound Name | 2-(oxan-2-yloxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]thiazine |
|---|---|
| PubChem CID | 155776024 |
| Molecular Formula | C18H29BN2O4S |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 2-(oxan-2-yloxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]thiazine |
| SMILES | CC1(C)OB(c2c(COC3CCCCO3)nn3c2CSCC3)OC1(C)C |
| InChI | InChI=1S/C18H29BN2O4S/c1-17(2)18(3,4)25-19(24-17)16-13(11-23-15-7-5-6-9-22-15)20-21-8-10-26-12-14(16)21/h15H,5-12H2,1-4H3 |
| InChIKey | KFRWGQJTNZZIQG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|