C20H31BO5 — CID 140883189
4,4,5,5-tetramethyl-2-[2-[2-(oxan-2-yloxy)ethoxymethyl]phenyl]-1,3,2-dioxaborolane (PubChem CID 140883189) has the molecular formula C20H31BO5 and a molecular weight of 362.28 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[2-[2-(oxan-2-yloxy)ethoxymethyl]phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[2-[2-(oxan-2-yloxy)ethoxymethyl]phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 140883189 |
| Molecular Formula | C20H31BO5 |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[2-[2-(oxan-2-yloxy)ethoxymethyl]phenyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccccc2COCCOC2CCCCO2)OC1(C)C |
| InChI | InChI=1S/C20H31BO5/c1-19(2)20(3,4)26-21(25-19)17-10-6-5-9-16(17)15-22-13-14-24-18-11-7-8-12-23-18/h5-6,9-10,18H,7-8,11-15H2,1-4H3 |
| InChIKey | RERYKJOPZSAACQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|