C20H39BO4 — CID 138111435
4,4,5,5-tetramethyl-2-[9-(oxan-2-yloxy)nonyl]-1,3,2-dioxaborolane (PubChem CID 138111435) has the molecular formula C20H39BO4 and a molecular weight of 354.34 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[9-(oxan-2-yloxy)nonyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[9-(oxan-2-yloxy)nonyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 138111435 |
| Molecular Formula | C20H39BO4 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.29 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[9-(oxan-2-yloxy)nonyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(CCCCCCCCCOC2CCCCO2)OC1(C)C |
| InChI | InChI=1S/C20H39BO4/c1-19(2)20(3,4)25-21(24-19)15-11-8-6-5-7-9-12-16-22-18-14-10-13-17-23-18/h18H,5-17H2,1-4H3 |
| InChIKey | ADXFQBNZFSZLRI-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|