C37H54BNO6 — CID 59413845
tert-butyl 2-(benzhydrylideneamino)-2-[3-(oxan-2-yloxy)propyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate (PubChem CID 59413845) has the molecular formula C37H54BNO6 and a molecular weight of 619.65 g/mol. Its IUPAC name is tert-butyl 2-(benzhydrylideneamino)-2-[3-(oxan-2-yloxy)propyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate.
| Compound Name | tert-butyl 2-(benzhydrylideneamino)-2-[3-(oxan-2-yloxy)propyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
|---|---|
| PubChem CID | 59413845 |
| Molecular Formula | C37H54BNO6 |
| Molecular Weight | 619.65 g/mol |
| Exact Mass | 619.40 |
| IUPAC Name | tert-butyl 2-(benzhydrylideneamino)-2-[3-(oxan-2-yloxy)propyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
| SMILES | CC(C)(C)OC(=O)C(CCCCB1OC(C)(C)C(C)(C)O1)(CCCOC1CCCCO1)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H54BNO6/c1-34(2,3)43-33(40)37(25-18-28-42-31-23-14-17-27-41-31,24-15-16-26-38-44-35(4,5)36(6,7)45-38)39-32(29-19-10-8-11-20-29)30-21-12-9-13-22-30/h8-13,19-22,31H,14-18,23-28H2,1-7H3 |
| InChIKey | RXUANKICIBLKIL-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.65 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|