C27H36BNO4 — CID 71580206
2-(benzhydrylideneamino)-2-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoic acid (PubChem CID 71580206) has the molecular formula C27H36BNO4 and a molecular weight of 449.40 g/mol. Its IUPAC name is 2-(benzhydrylideneamino)-2-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoic acid.
| Compound Name | 2-(benzhydrylideneamino)-2-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoic acid |
|---|---|
| PubChem CID | 71580206 |
| Molecular Formula | C27H36BNO4 |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 2-(benzhydrylideneamino)-2-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoic acid |
| SMILES | CCC(CCCCB1OC(C)(C)C(C)(C)O1)(N=C(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C27H36BNO4/c1-6-27(24(30)31,19-13-14-20-28-32-25(2,3)26(4,5)33-28)29-23(21-15-9-7-10-16-21)22-17-11-8-12-18-22/h7-12,15-18H,6,13-14,19-20H2,1-5H3,(H,30,31) |
| InChIKey | VBICIEGVHOPVHF-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|