C38H48BNO6 — CID 59413839
4-O-benzyl 1-O-tert-butyl 2-(benzhydrylideneamino)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]butanedioate (PubChem CID 59413839) has the molecular formula C38H48BNO6 and a molecular weight of 625.62 g/mol. Its IUPAC name is 4-O-benzyl 1-O-tert-butyl 2-(benzhydrylideneamino)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]butanedioate.
| Compound Name | 4-O-benzyl 1-O-tert-butyl 2-(benzhydrylideneamino)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]butanedioate |
|---|---|
| PubChem CID | 59413839 |
| Molecular Formula | C38H48BNO6 |
| Molecular Weight | 625.62 g/mol |
| Exact Mass | 625.36 |
| IUPAC Name | 4-O-benzyl 1-O-tert-butyl 2-(benzhydrylideneamino)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]butanedioate |
| SMILES | CC(C)(C)OC(=O)C(CCCCB1OC(C)(C)C(C)(C)O1)(CC(=O)OCc1ccccc1)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H48BNO6/c1-35(2,3)44-34(42)38(27-32(41)43-28-29-19-11-8-12-20-29,25-17-18-26-39-45-36(4,5)37(6,7)46-39)40-33(30-21-13-9-14-22-30)31-23-15-10-16-24-31/h8-16,19-24H,17-18,25-28H2,1-7H3 |
| InChIKey | OUNXPMDITBQADU-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.62 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|