C33H46BNO4 — CID 59413885
tert-butyl (E)-2-(benzhydrylideneamino)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]hex-4-enoate (PubChem CID 59413885) has the molecular formula C33H46BNO4 and a molecular weight of 531.55 g/mol. Its IUPAC name is tert-butyl (E)-2-(benzhydrylideneamino)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]hex-4-enoate.
| Compound Name | tert-butyl (E)-2-(benzhydrylideneamino)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]hex-4-enoate |
|---|---|
| PubChem CID | 59413885 |
| Molecular Formula | C33H46BNO4 |
| Molecular Weight | 531.55 g/mol |
| Exact Mass | 531.35 |
| IUPAC Name | tert-butyl (E)-2-(benzhydrylideneamino)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]hex-4-enoate |
| SMILES | C/C=C/CC(CCCCB1OC(C)(C)C(C)(C)O1)(N=C(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H46BNO4/c1-9-10-23-33(29(36)37-30(2,3)4,24-17-18-25-34-38-31(5,6)32(7,8)39-34)35-28(26-19-13-11-14-20-26)27-21-15-12-16-22-27/h9-16,19-22H,17-18,23-25H2,1-8H3/b10-9+ |
| InChIKey | LYXZBOVVPVEIFI-MDZDMXLPSA-N |
| XLogP | 7.83 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.55 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|