C30H31NO3 — CID 86663724
tert-butyl 2-(benzhydrylideneamino)-2-benzoylhex-5-enoate (PubChem CID 86663724) has the molecular formula C30H31NO3 and a molecular weight of 453.58 g/mol. Its IUPAC name is tert-butyl 2-(benzhydrylideneamino)-2-benzoylhex-5-enoate.
| Compound Name | tert-butyl 2-(benzhydrylideneamino)-2-benzoylhex-5-enoate |
|---|---|
| PubChem CID | 86663724 |
| Molecular Formula | C30H31NO3 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | tert-butyl 2-(benzhydrylideneamino)-2-benzoylhex-5-enoate |
| SMILES | C=CCCC(N=C(c1ccccc1)c1ccccc1)(C(=O)OC(C)(C)C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C30H31NO3/c1-5-6-22-30(28(33)34-29(2,3)4,27(32)25-20-14-9-15-21-25)31-26(23-16-10-7-11-17-23)24-18-12-8-13-19-24/h5,7-21H,1,6,22H2,2-4H3 |
| InChIKey | GSDSFPMZIRTIGI-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|