C23H25NO4 — CID 175701852
(E)-4-(benzhydrylideneamino)-2-methyl-5-[(2-methylpropan-2-yl)oxy]-5-oxopent-3-enoic acid (PubChem CID 175701852) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is (E)-4-(benzhydrylideneamino)-2-methyl-5-[(2-methylpropan-2-yl)oxy]-5-oxopent-3-enoic acid.
| Compound Name | (E)-4-(benzhydrylideneamino)-2-methyl-5-[(2-methylpropan-2-yl)oxy]-5-oxopent-3-enoic acid |
|---|---|
| PubChem CID | 175701852 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | (E)-4-(benzhydrylideneamino)-2-methyl-5-[(2-methylpropan-2-yl)oxy]-5-oxopent-3-enoic acid |
| SMILES | CC(/C=C(/N=C(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C23H25NO4/c1-16(21(25)26)15-19(22(27)28-23(2,3)4)24-20(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-16H,1-4H3,(H,25,26)/b19-15+ |
| InChIKey | VOIRWGDNFLLQES-XDJHFCHBSA-N |
| XLogP | 4.47 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|