C23H25NO4 — CID 177399381
5-O-ethyl 1-O-methyl (E)-2-(benzhydrylideneamino)-4,4-dimethylpent-2-enedioate (PubChem CID 177399381) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 5-O-ethyl 1-O-methyl (E)-2-(benzhydrylideneamino)-4,4-dimethylpent-2-enedioate.
| Compound Name | 5-O-ethyl 1-O-methyl (E)-2-(benzhydrylideneamino)-4,4-dimethylpent-2-enedioate |
|---|---|
| PubChem CID | 177399381 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 5-O-ethyl 1-O-methyl (E)-2-(benzhydrylideneamino)-4,4-dimethylpent-2-enedioate |
| SMILES | CCOC(=O)C(C)(C)/C=C(/N=C(c1ccccc1)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C23H25NO4/c1-5-28-22(26)23(2,3)16-19(21(25)27-4)24-20(17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-16H,5H2,1-4H3/b19-16+ |
| InChIKey | INSWTWMQCNGBDR-KNTRCKAVSA-N |
| XLogP | 4.17 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|