C16H20BrNO3 — CID 132579994
ethyl (Z)-4-acetamido-4-(4-bromophenyl)-2,2-dimethylbut-3-enoate (PubChem CID 132579994) has the molecular formula C16H20BrNO3 and a molecular weight of 354.24 g/mol. Its IUPAC name is ethyl (Z)-4-acetamido-4-(4-bromophenyl)-2,2-dimethylbut-3-enoate.
| Compound Name | ethyl (Z)-4-acetamido-4-(4-bromophenyl)-2,2-dimethylbut-3-enoate |
|---|---|
| PubChem CID | 132579994 |
| Molecular Formula | C16H20BrNO3 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | ethyl (Z)-4-acetamido-4-(4-bromophenyl)-2,2-dimethylbut-3-enoate |
| SMILES | CCOC(=O)C(C)(C)/C=C(\NC(C)=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H20BrNO3/c1-5-21-15(20)16(3,4)10-14(18-11(2)19)12-6-8-13(17)9-7-12/h6-10H,5H2,1-4H3,(H,18,19)/b14-10- |
| InChIKey | OBZOREZEHFTZPT-UVTDQMKNSA-N |
| XLogP | 3.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |