C19H18Br2O6 — CID 154094216
diethyl 2,2-bis(4-bromophenoxy)propanedioate (PubChem CID 154094216) has the molecular formula C19H18Br2O6 and a molecular weight of 502.16 g/mol. Its IUPAC name is diethyl 2,2-bis(4-bromophenoxy)propanedioate.
| Compound Name | diethyl 2,2-bis(4-bromophenoxy)propanedioate |
|---|---|
| PubChem CID | 154094216 |
| Molecular Formula | C19H18Br2O6 |
| Molecular Weight | 502.16 g/mol |
| Exact Mass | 499.95 |
| IUPAC Name | diethyl 2,2-bis(4-bromophenoxy)propanedioate |
| SMILES | CCOC(=O)C(Oc1ccc(Br)cc1)(Oc1ccc(Br)cc1)C(=O)OCC |
| InChI | InChI=1S/C19H18Br2O6/c1-3-24-17(22)19(18(23)25-4-2,26-15-9-5-13(20)6-10-15)27-16-11-7-14(21)8-12-16/h5-12H,3-4H2,1-2H3 |
| InChIKey | CVUWIDHMPAIDPN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.16 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|