diethyl 2,2-bis(4-bromophenoxy)propanedioate

C19H18Br2O6 — CID 154094216

IUPACdiethyl 2,2-bis(4-bromophenoxy)propanedioate
SMILESCCOC(=O)C(Oc1ccc(Br)cc1)(Oc1ccc(Br)cc1)C(=O)OCC
InChIInChI=1S/C19H18Br2O6/c1-3-24-17(22)19(18(23)25-4-2,26-15-9-5-13(20)6-10-15)27-16-11-7-14(21)8-12-16/h5-12H,3-4H2,1-2H3
InChIKeyCVUWIDHMPAIDPN-UHFFFAOYSA-N
MW502.16 g/mol
LogP4.49
Rot. Bonds8

About diethyl 2,2-bis(4-bromophenoxy)propanedioate

diethyl 2,2-bis(4-bromophenoxy)propanedioate (PubChem CID 154094216) has the molecular formula C19H18Br2O6 and a molecular weight of 502.16 g/mol. Its IUPAC name is diethyl 2,2-bis(4-bromophenoxy)propanedioate.

Molecular Properties

Compound Namediethyl 2,2-bis(4-bromophenoxy)propanedioate
PubChem CID154094216
Molecular FormulaC19H18Br2O6
Molecular Weight502.16 g/mol
Exact Mass499.95
IUPAC Namediethyl 2,2-bis(4-bromophenoxy)propanedioate
SMILESCCOC(=O)C(Oc1ccc(Br)cc1)(Oc1ccc(Br)cc1)C(=O)OCC
InChIInChI=1S/C19H18Br2O6/c1-3-24-17(22)19(18(23)25-4-2,26-15-9-5-13(20)6-10-15)27-16-11-7-14(21)8-12-16/h5-12H,3-4H2,1-2H3
InChIKeyCVUWIDHMPAIDPN-UHFFFAOYSA-N
XLogP4.49
TPSA71.06 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500502.16
LogP ≤ 54.49
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze diethyl 2,2-bis(4-bromophenoxy)propanedioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of diethyl 2,2-bis(4-bromophenoxy)propanedioate?
The IUPAC name of diethyl 2,2-bis(4-bromophenoxy)propanedioate (CID 154094216) is diethyl 2,2-bis(4-bromophenoxy)propanedioate.
What is the SMILES notation for diethyl 2,2-bis(4-bromophenoxy)propanedioate?
The canonical SMILES for diethyl 2,2-bis(4-bromophenoxy)propanedioate is CCOC(=O)C(Oc1ccc(Br)cc1)(Oc1ccc(Br)cc1)C(=O)OCC.
What is the InChIKey of diethyl 2,2-bis(4-bromophenoxy)propanedioate?
The InChIKey is CVUWIDHMPAIDPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18Br2O6/c1-3-24-17(22)19(18(23)25-4-2,26-15-9-5-13(20)6-10-15)27-16-11-7-14(21)8-12-16/h5-12H,3-4H2,1-2H3.
What are the key properties of diethyl 2,2-bis(4-bromophenoxy)propanedioate?
diethyl 2,2-bis(4-bromophenoxy)propanedioate has a molecular weight of 502.16 g/mol, XLogP of 4.49, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2,2-bis(4-bromophenoxy)propanedioate is sourced from PubChem (CID 154094216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).