C20H23NO2 — CID 175974441
tert-butyl 2-(benzhydrylideneamino)-3,3,3-trideuteriopropanoate (PubChem CID 175974441) has the molecular formula C20H23NO2 and a molecular weight of 312.43 g/mol. Its IUPAC name is tert-butyl 2-(benzhydrylideneamino)-3,3,3-trideuteriopropanoate.
| Compound Name | tert-butyl 2-(benzhydrylideneamino)-3,3,3-trideuteriopropanoate |
|---|---|
| PubChem CID | 175974441 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | tert-butyl 2-(benzhydrylideneamino)-3,3,3-trideuteriopropanoate |
| SMILES | [2H]C([2H])([2H])C(N=C(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H23NO2/c1-15(19(22)23-20(2,3)4)21-18(16-11-7-5-8-12-16)17-13-9-6-10-14-17/h5-15H,1-4H3/i1D3 |
| InChIKey | NLEOBKQKFNFGNY-FIBGUPNXSA-N |
| XLogP | 4.25 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|