C24H29NO4 — CID 73300495
5-O-tert-butyl 1-O-methyl 4-(benzhydrylideneamino)-2-methylpentanedioate (PubChem CID 73300495) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-methyl 4-(benzhydrylideneamino)-2-methylpentanedioate.
| Compound Name | 5-O-tert-butyl 1-O-methyl 4-(benzhydrylideneamino)-2-methylpentanedioate |
|---|---|
| PubChem CID | 73300495 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 5-O-tert-butyl 1-O-methyl 4-(benzhydrylideneamino)-2-methylpentanedioate |
| SMILES | COC(=O)C(C)CC(N=C(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H29NO4/c1-17(22(26)28-5)16-20(23(27)29-24(2,3)4)25-21(18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,17,20H,16H2,1-5H3 |
| InChIKey | GHTMDQHAVBSOMT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|