C23H27NO2 — CID 11360059
tert-butyl (2S)-2-(benzhydrylideneamino)-4-methylpent-4-enoate (PubChem CID 11360059) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is tert-butyl (2S)-2-(benzhydrylideneamino)-4-methylpent-4-enoate.
| Compound Name | tert-butyl (2S)-2-(benzhydrylideneamino)-4-methylpent-4-enoate |
|---|---|
| PubChem CID | 11360059 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | tert-butyl (2S)-2-(benzhydrylideneamino)-4-methylpent-4-enoate |
| SMILES | C=C(C)C[C@H](N=C(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H27NO2/c1-17(2)16-20(22(25)26-23(3,4)5)24-21(18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,20H,1,16H2,2-5H3/t20-/m0/s1 |
| InChIKey | NEJRWXWMFMXPOJ-FQEVSTJZSA-N |
| XLogP | 5.20 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|