C22H29NO2Si — CID 174032686
tert-butyl (2R)-2-(benzhydrylideneamino)-3-dimethylsilylpropanoate (PubChem CID 174032686) has the molecular formula C22H29NO2Si and a molecular weight of 367.56 g/mol. Its IUPAC name is tert-butyl (2R)-2-(benzhydrylideneamino)-3-dimethylsilylpropanoate.
| Compound Name | tert-butyl (2R)-2-(benzhydrylideneamino)-3-dimethylsilylpropanoate |
|---|---|
| PubChem CID | 174032686 |
| Molecular Formula | C22H29NO2Si |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | tert-butyl (2R)-2-(benzhydrylideneamino)-3-dimethylsilylpropanoate |
| SMILES | C[SiH](C)C[C@H](N=C(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H29NO2Si/c1-22(2,3)25-21(24)19(16-26(4)5)23-20(17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-15,19,26H,16H2,1-5H3/t19-/m0/s1 |
| InChIKey | FOQJZNIGSKNPMK-IBGZPJMESA-N |
| XLogP | 4.72 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|