C30H33NO2 — CID 138660032
tert-butyl (2S)-2-(benzhydrylideneamino)-3-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoate (PubChem CID 138660032) has the molecular formula C30H33NO2 and a molecular weight of 439.60 g/mol. Its IUPAC name is tert-butyl (2S)-2-(benzhydrylideneamino)-3-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoate.
| Compound Name | tert-butyl (2S)-2-(benzhydrylideneamino)-3-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 138660032 |
| Molecular Formula | C30H33NO2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | tert-butyl (2S)-2-(benzhydrylideneamino)-3-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](Cc1ccc2c(c1)CCCC2)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H33NO2/c1-30(2,3)33-29(32)27(21-22-18-19-23-12-10-11-17-26(23)20-22)31-28(24-13-6-4-7-14-24)25-15-8-5-9-16-25/h4-9,13-16,18-20,27H,10-12,17,21H2,1-3H3/t27-/m0/s1 |
| InChIKey | KPYCHDDWYUDCKE-MHZLTWQESA-N |
| XLogP | 6.36 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|