C26H26INO2 — CID 74369383
tert-butyl 2-(benzhydrylideneamino)-3-(2-iodophenyl)propanoate (PubChem CID 74369383) has the molecular formula C26H26INO2 and a molecular weight of 511.40 g/mol. Its IUPAC name is tert-butyl 2-(benzhydrylideneamino)-3-(2-iodophenyl)propanoate.
| Compound Name | tert-butyl 2-(benzhydrylideneamino)-3-(2-iodophenyl)propanoate |
|---|---|
| PubChem CID | 74369383 |
| Molecular Formula | C26H26INO2 |
| Molecular Weight | 511.40 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | tert-butyl 2-(benzhydrylideneamino)-3-(2-iodophenyl)propanoate |
| SMILES | CC(C)(C)OC(=O)C(Cc1ccccc1I)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H26INO2/c1-26(2,3)30-25(29)23(18-21-16-10-11-17-22(21)27)28-24(19-12-6-4-7-13-19)20-14-8-5-9-15-20/h4-17,23H,18H2,1-3H3 |
| InChIKey | ASGOTCBNOSMETI-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.40 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|