C22H27NO3 — CID 125473245
tert-butyl (2S)-2-(benzhydrylideneamino)-4-methoxybutanoate (PubChem CID 125473245) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is tert-butyl (2S)-2-(benzhydrylideneamino)-4-methoxybutanoate.
| Compound Name | tert-butyl (2S)-2-(benzhydrylideneamino)-4-methoxybutanoate |
|---|---|
| PubChem CID | 125473245 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | tert-butyl (2S)-2-(benzhydrylideneamino)-4-methoxybutanoate |
| SMILES | COCC[C@H](N=C(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H27NO3/c1-22(2,3)26-21(24)19(15-16-25-4)23-20(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,19H,15-16H2,1-4H3/t19-/m0/s1 |
| InChIKey | CNKJDZSIGQBEMF-IBGZPJMESA-N |
| XLogP | 4.27 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|