C27H31NO3 — CID 16658432
tert-butyl (2S)-2-(benzhydrylideneamino)-4-(3-oxocyclohexen-1-yl)butanoate (PubChem CID 16658432) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is tert-butyl (2S)-2-(benzhydrylideneamino)-4-(3-oxocyclohexen-1-yl)butanoate.
| Compound Name | tert-butyl (2S)-2-(benzhydrylideneamino)-4-(3-oxocyclohexen-1-yl)butanoate |
|---|---|
| PubChem CID | 16658432 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | tert-butyl (2S)-2-(benzhydrylideneamino)-4-(3-oxocyclohexen-1-yl)butanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CCC1=CC(=O)CCC1)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H31NO3/c1-27(2,3)31-26(30)24(18-17-20-11-10-16-23(29)19-20)28-25(21-12-6-4-7-13-21)22-14-8-5-9-15-22/h4-9,12-15,19,24H,10-11,16-18H2,1-3H3/t24-/m0/s1 |
| InChIKey | KDFOGCKMUZAPAT-DEOSSOPVSA-N |
| XLogP | 5.69 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|