C27H28N2O3 — CID 46873349
tert-butyl (2R)-2-(benzhydrylideneamino)-5-oxo-5-pyridin-3-ylpentanoate (PubChem CID 46873349) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is tert-butyl (2R)-2-(benzhydrylideneamino)-5-oxo-5-pyridin-3-ylpentanoate.
| Compound Name | tert-butyl (2R)-2-(benzhydrylideneamino)-5-oxo-5-pyridin-3-ylpentanoate |
|---|---|
| PubChem CID | 46873349 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | tert-butyl (2R)-2-(benzhydrylideneamino)-5-oxo-5-pyridin-3-ylpentanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](CCC(=O)c1cccnc1)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H28N2O3/c1-27(2,3)32-26(31)23(16-17-24(30)22-15-10-18-28-19-22)29-25(20-11-6-4-7-12-20)21-13-8-5-9-14-21/h4-15,18-19,23H,16-17H2,1-3H3/t23-/m1/s1 |
| InChIKey | PEIPGENEDZVXCZ-HSZRJFAPSA-N |
| XLogP | 5.29 |
| TPSA | 68.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|