C29H31NO2 — CID 138660301
tert-butyl (2S)-2-(benzhydrylideneamino)-3-(2,3-dihydro-1H-inden-5-yl)propanoate (PubChem CID 138660301) has the molecular formula C29H31NO2 and a molecular weight of 425.57 g/mol. Its IUPAC name is tert-butyl (2S)-2-(benzhydrylideneamino)-3-(2,3-dihydro-1H-inden-5-yl)propanoate.
| Compound Name | tert-butyl (2S)-2-(benzhydrylideneamino)-3-(2,3-dihydro-1H-inden-5-yl)propanoate |
|---|---|
| PubChem CID | 138660301 |
| Molecular Formula | C29H31NO2 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | tert-butyl (2S)-2-(benzhydrylideneamino)-3-(2,3-dihydro-1H-inden-5-yl)propanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](Cc1ccc2c(c1)CCC2)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H31NO2/c1-29(2,3)32-28(31)26(20-21-17-18-22-15-10-16-25(22)19-21)30-27(23-11-6-4-7-12-23)24-13-8-5-9-14-24/h4-9,11-14,17-19,26H,10,15-16,20H2,1-3H3/t26-/m0/s1 |
| InChIKey | DAFFVGAAIIAZON-SANMLTNESA-N |
| XLogP | 5.97 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|