C27H25FN2O2 — CID 87083367
tert-butyl 2-(benzhydrylideneamino)-3-(4-cyano-3-fluorophenyl)propanoate (PubChem CID 87083367) has the molecular formula C27H25FN2O2 and a molecular weight of 428.51 g/mol. Its IUPAC name is tert-butyl 2-(benzhydrylideneamino)-3-(4-cyano-3-fluorophenyl)propanoate.
| Compound Name | tert-butyl 2-(benzhydrylideneamino)-3-(4-cyano-3-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 87083367 |
| Molecular Formula | C27H25FN2O2 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | tert-butyl 2-(benzhydrylideneamino)-3-(4-cyano-3-fluorophenyl)propanoate |
| SMILES | CC(C)(C)OC(=O)C(Cc1ccc(C#N)c(F)c1)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H25FN2O2/c1-27(2,3)32-26(31)24(17-19-14-15-22(18-29)23(28)16-19)30-25(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-16,24H,17H2,1-3H3 |
| InChIKey | RSFQZBQXFLEOEX-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|