C27H31BrN2O2 — CID 134501803
tert-butyl (2S,4E,5Z,7E)-4-[amino(bromo)methylidene]-2-(benzhydrylideneamino)nona-5,7-dienoate (PubChem CID 134501803) has the molecular formula C27H31BrN2O2 and a molecular weight of 495.46 g/mol. Its IUPAC name is tert-butyl (2S,4E,5Z,7E)-4-[amino(bromo)methylidene]-2-(benzhydrylideneamino)nona-5,7-dienoate.
| Compound Name | tert-butyl (2S,4E,5Z,7E)-4-[amino(bromo)methylidene]-2-(benzhydrylideneamino)nona-5,7-dienoate |
|---|---|
| PubChem CID | 134501803 |
| Molecular Formula | C27H31BrN2O2 |
| Molecular Weight | 495.46 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | tert-butyl (2S,4E,5Z,7E)-4-[amino(bromo)methylidene]-2-(benzhydrylideneamino)nona-5,7-dienoate |
| SMILES | C/C=C/C=C\C(C[C@H](N=C(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C)=C(/N)Br |
| InChI | InChI=1S/C27H31BrN2O2/c1-5-6-9-18-22(25(28)29)19-23(26(31)32-27(2,3)4)30-24(20-14-10-7-11-15-20)21-16-12-8-13-17-21/h5-18,23H,19,29H2,1-4H3/b6-5+,18-9-,25-22+/t23-/m0/s1 |
| InChIKey | YFMINWWHEXMZHD-KKZVSAJBSA-N |
| XLogP | 6.32 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.46 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|