C33H44N2O6 — CID 4867483
tert-butyl 2-(benzhydrylideneamino)-3-[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopropyl]propanoate (PubChem CID 4867483) has the molecular formula C33H44N2O6 and a molecular weight of 564.72 g/mol. Its IUPAC name is tert-butyl 2-(benzhydrylideneamino)-3-[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopropyl]propanoate.
| Compound Name | tert-butyl 2-(benzhydrylideneamino)-3-[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopropyl]propanoate |
|---|---|
| PubChem CID | 4867483 |
| Molecular Formula | C33H44N2O6 |
| Molecular Weight | 564.72 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | tert-butyl 2-(benzhydrylideneamino)-3-[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopropyl]propanoate |
| SMILES | CC(C)(C)OC(=O)C(CC1CC1N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H44N2O6/c1-31(2,3)39-28(36)25(34-27(22-16-12-10-13-17-22)23-18-14-11-15-19-23)20-24-21-26(24)35(29(37)40-32(4,5)6)30(38)41-33(7,8)9/h10-19,24-26H,20-21H2,1-9H3 |
| InChIKey | VLCKRDXRAGHRES-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.72 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|