C26H27NO2 — CID 101192341
tert-butyl (2S)-2-(benzhydrylideneamino)-2-deuterio-3-phenylpropanoate (PubChem CID 101192341) has the molecular formula C26H27NO2 and a molecular weight of 386.51 g/mol. Its IUPAC name is tert-butyl (2S)-2-(benzhydrylideneamino)-2-deuterio-3-phenylpropanoate.
| Compound Name | tert-butyl (2S)-2-(benzhydrylideneamino)-2-deuterio-3-phenylpropanoate |
|---|---|
| PubChem CID | 101192341 |
| Molecular Formula | C26H27NO2 |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | tert-butyl (2S)-2-(benzhydrylideneamino)-2-deuterio-3-phenylpropanoate |
| SMILES | [2H][C@@](Cc1ccccc1)(N=C(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H27NO2/c1-26(2,3)29-25(28)23(19-20-13-7-4-8-14-20)27-24(21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-18,23H,19H2,1-3H3/t23-/m0/s1/i23D |
| InChIKey | HDCBZHATHZHGAC-NXYQXXSJSA-N |
| XLogP | 5.48 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|