C38H41N3O4 — CID 101231885
tert-butyl (2S)-2-[[(2S)-2-[[(2S)-2-(benzhydrylideneamino)-3-phenylpropanoyl]amino]propanoyl]amino]-3-phenylpropanoate (PubChem CID 101231885) has the molecular formula C38H41N3O4 and a molecular weight of 603.76 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-2-[[(2S)-2-(benzhydrylideneamino)-3-phenylpropanoyl]amino]propanoyl]amino]-3-phenylpropanoate.
| Compound Name | tert-butyl (2S)-2-[[(2S)-2-[[(2S)-2-(benzhydrylideneamino)-3-phenylpropanoyl]amino]propanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 101231885 |
| Molecular Formula | C38H41N3O4 |
| Molecular Weight | 603.76 g/mol |
| Exact Mass | 603.31 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-2-[[(2S)-2-(benzhydrylideneamino)-3-phenylpropanoyl]amino]propanoyl]amino]-3-phenylpropanoate |
| SMILES | C[C@H](NC(=O)[C@H](Cc1ccccc1)N=C(c1ccccc1)c1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H41N3O4/c1-27(35(42)41-33(37(44)45-38(2,3)4)26-29-19-11-6-12-20-29)39-36(43)32(25-28-17-9-5-10-18-28)40-34(30-21-13-7-14-22-30)31-23-15-8-16-24-31/h5-24,27,32-33H,25-26H2,1-4H3,(H,39,43)(H,41,42)/t27-,32-,33-/m0/s1 |
| InChIKey | SNEWEDNHZTVEHA-GIBUXBDZSA-N |
| XLogP | 5.71 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.76 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|