C19H20N2O4 — CID 102216090
methyl (2S,4S)-2-(benzhydrylideneamino)-4-nitropentanoate (PubChem CID 102216090) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is methyl (2S,4S)-2-(benzhydrylideneamino)-4-nitropentanoate.
| Compound Name | methyl (2S,4S)-2-(benzhydrylideneamino)-4-nitropentanoate |
|---|---|
| PubChem CID | 102216090 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | methyl (2S,4S)-2-(benzhydrylideneamino)-4-nitropentanoate |
| SMILES | COC(=O)[C@H](C[C@H](C)[N+](=O)[O-])N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O4/c1-14(21(23)24)13-17(19(22)25-2)20-18(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,14,17H,13H2,1-2H3/t14-,17-/m0/s1 |
| InChIKey | PTYNZPJGMFEMKB-YOEHRIQHSA-N |
| XLogP | 3.12 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|