C21H21NO2 — CID 10947131
methyl 2-(benzhydrylideneamino)hept-4-ynoate (PubChem CID 10947131) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is methyl 2-(benzhydrylideneamino)hept-4-ynoate.
| Compound Name | methyl 2-(benzhydrylideneamino)hept-4-ynoate |
|---|---|
| PubChem CID | 10947131 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | methyl 2-(benzhydrylideneamino)hept-4-ynoate |
| SMILES | CCC#CCC(N=C(c1ccccc1)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C21H21NO2/c1-3-4-7-16-19(21(23)24-2)22-20(17-12-8-5-9-13-17)18-14-10-6-11-15-18/h5-6,8-15,19H,3,16H2,1-2H3 |
| InChIKey | VUBLWSAFISJJIV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|