C36H37NO2Si — CID 10007553
ethyl 2-(benzhydrylideneamino)-5-[tert-butyl(diphenyl)silyl]pent-4-ynoate (PubChem CID 10007553) has the molecular formula C36H37NO2Si and a molecular weight of 543.78 g/mol. Its IUPAC name is ethyl 2-(benzhydrylideneamino)-5-[tert-butyl(diphenyl)silyl]pent-4-ynoate.
| Compound Name | ethyl 2-(benzhydrylideneamino)-5-[tert-butyl(diphenyl)silyl]pent-4-ynoate |
|---|---|
| PubChem CID | 10007553 |
| Molecular Formula | C36H37NO2Si |
| Molecular Weight | 543.78 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | ethyl 2-(benzhydrylideneamino)-5-[tert-butyl(diphenyl)silyl]pent-4-ynoate |
| SMILES | CCOC(=O)C(CC#C[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H37NO2Si/c1-5-39-35(38)33(37-34(29-19-10-6-11-20-29)30-21-12-7-13-22-30)27-18-28-40(36(2,3)4,31-23-14-8-15-24-31)32-25-16-9-17-26-32/h6-17,19-26,33H,5,27H2,1-4H3 |
| InChIKey | FYMHDCNYGCNZQD-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.78 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|