C24H24N2O3 — CID 87058701
ethyl 2-(benzhydrylideneamino)-3-(2-methoxy-3-pyridinyl)propanoate (PubChem CID 87058701) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is ethyl 2-(benzhydrylideneamino)-3-(2-methoxy-3-pyridinyl)propanoate.
| Compound Name | ethyl 2-(benzhydrylideneamino)-3-(2-methoxy-3-pyridinyl)propanoate |
|---|---|
| PubChem CID | 87058701 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | ethyl 2-(benzhydrylideneamino)-3-(2-methoxy-3-pyridinyl)propanoate |
| SMILES | CCOC(=O)C(Cc1cccnc1OC)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O3/c1-3-29-24(27)21(17-20-15-10-16-25-23(20)28-2)26-22(18-11-6-4-7-12-18)19-13-8-5-9-14-19/h4-16,21H,3,17H2,1-2H3 |
| InChIKey | SZIZTEUWRCPEQJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|