C29H25NO3S — CID 102090882
ethyl (2R)-2-(benzhydrylideneamino)-3-[4-(5-formylthiophen-3-yl)phenyl]propanoate (PubChem CID 102090882) has the molecular formula C29H25NO3S and a molecular weight of 467.59 g/mol. Its IUPAC name is ethyl (2R)-2-(benzhydrylideneamino)-3-[4-(5-formylthiophen-3-yl)phenyl]propanoate.
| Compound Name | ethyl (2R)-2-(benzhydrylideneamino)-3-[4-(5-formylthiophen-3-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 102090882 |
| Molecular Formula | C29H25NO3S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | ethyl (2R)-2-(benzhydrylideneamino)-3-[4-(5-formylthiophen-3-yl)phenyl]propanoate |
| SMILES | CCOC(=O)[C@@H](Cc1ccc(-c2csc(C=O)c2)cc1)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H25NO3S/c1-2-33-29(32)27(17-21-13-15-22(16-14-21)25-18-26(19-31)34-20-25)30-28(23-9-5-3-6-10-23)24-11-7-4-8-12-24/h3-16,18-20,27H,2,17H2,1H3/t27-/m1/s1 |
| InChIKey | BCNKKJLXBSJDLQ-HHHXNRCGSA-N |
| XLogP | 6.24 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|