C39H34N4O2 — CID 90396072
ethyl 2-(benzhydrylideneamino)-3-(1-trityl-1,2,4-triazol-3-yl)propanoate (PubChem CID 90396072) has the molecular formula C39H34N4O2 and a molecular weight of 590.73 g/mol. Its IUPAC name is ethyl 2-(benzhydrylideneamino)-3-(1-trityl-1,2,4-triazol-3-yl)propanoate.
| Compound Name | ethyl 2-(benzhydrylideneamino)-3-(1-trityl-1,2,4-triazol-3-yl)propanoate |
|---|---|
| PubChem CID | 90396072 |
| Molecular Formula | C39H34N4O2 |
| Molecular Weight | 590.73 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | ethyl 2-(benzhydrylideneamino)-3-(1-trityl-1,2,4-triazol-3-yl)propanoate |
| SMILES | CCOC(=O)C(Cc1ncn(C(c2ccccc2)(c2ccccc2)c2ccccc2)n1)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H34N4O2/c1-2-45-38(44)35(41-37(30-18-8-3-9-19-30)31-20-10-4-11-21-31)28-36-40-29-43(42-36)39(32-22-12-5-13-23-32,33-24-14-6-15-25-33)34-26-16-7-17-27-34/h3-27,29,35H,2,28H2,1H3 |
| InChIKey | IIJLLXUIXXHRNG-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 69.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.73 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|