C31H34N4O4 — CID 90396073
ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1-trityl-1,2,4-triazol-3-yl)propanoate (PubChem CID 90396073) has the molecular formula C31H34N4O4 and a molecular weight of 526.64 g/mol. Its IUPAC name is ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1-trityl-1,2,4-triazol-3-yl)propanoate.
| Compound Name | ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1-trityl-1,2,4-triazol-3-yl)propanoate |
|---|---|
| PubChem CID | 90396073 |
| Molecular Formula | C31H34N4O4 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1-trityl-1,2,4-triazol-3-yl)propanoate |
| SMILES | CCOC(=O)C(Cc1ncn(C(c2ccccc2)(c2ccccc2)c2ccccc2)n1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H34N4O4/c1-5-38-28(36)26(33-29(37)39-30(2,3)4)21-27-32-22-35(34-27)31(23-15-9-6-10-16-23,24-17-11-7-12-18-24)25-19-13-8-14-20-25/h6-20,22,26H,5,21H2,1-4H3,(H,33,37) |
| InChIKey | LAZJXICWVSVVAH-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|