C25H24BrNO2 — CID 174437990
ethyl 2-(benzhydrylideneamino)-3-[2-(bromomethyl)phenyl]propanoate (PubChem CID 174437990) has the molecular formula C25H24BrNO2 and a molecular weight of 450.38 g/mol. Its IUPAC name is ethyl 2-(benzhydrylideneamino)-3-[2-(bromomethyl)phenyl]propanoate.
| Compound Name | ethyl 2-(benzhydrylideneamino)-3-[2-(bromomethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 174437990 |
| Molecular Formula | C25H24BrNO2 |
| Molecular Weight | 450.38 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | ethyl 2-(benzhydrylideneamino)-3-[2-(bromomethyl)phenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1CBr)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H24BrNO2/c1-2-29-25(28)23(17-21-15-9-10-16-22(21)18-26)27-24(19-11-5-3-6-12-19)20-13-7-4-8-14-20/h3-16,23H,2,17-18H2,1H3 |
| InChIKey | LBMUGRKOLLIPMF-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.38 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|