C28H28N2O2S — CID 10837529
ethyl 2-(benzhydrylideneamino)-3-(2-ethylsulfanyl-1H-indol-3-yl)propanoate (PubChem CID 10837529) has the molecular formula C28H28N2O2S and a molecular weight of 456.61 g/mol. Its IUPAC name is ethyl 2-(benzhydrylideneamino)-3-(2-ethylsulfanyl-1H-indol-3-yl)propanoate.
| Compound Name | ethyl 2-(benzhydrylideneamino)-3-(2-ethylsulfanyl-1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 10837529 |
| Molecular Formula | C28H28N2O2S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | ethyl 2-(benzhydrylideneamino)-3-(2-ethylsulfanyl-1H-indol-3-yl)propanoate |
| SMILES | CCOC(=O)C(Cc1c(SCC)[nH]c2ccccc12)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H28N2O2S/c1-3-32-28(31)25(19-23-22-17-11-12-18-24(22)30-27(23)33-4-2)29-26(20-13-7-5-8-14-20)21-15-9-6-10-16-21/h5-18,25,30H,3-4,19H2,1-2H3 |
| InChIKey | MRUPCBSELSDKHJ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 54.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|