C14H19NO2S — CID 10890785
2-[(2-ethylsulfanyl-1H-indol-3-yl)methyl]propane-1,3-diol (PubChem CID 10890785) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is 2-[(2-ethylsulfanyl-1H-indol-3-yl)methyl]propane-1,3-diol.
| Compound Name | 2-[(2-ethylsulfanyl-1H-indol-3-yl)methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 10890785 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-[(2-ethylsulfanyl-1H-indol-3-yl)methyl]propane-1,3-diol |
| SMILES | CCSc1[nH]c2ccccc2c1CC(CO)CO |
| InChI | InChI=1S/C14H19NO2S/c1-2-18-14-12(7-10(8-16)9-17)11-5-3-4-6-13(11)15-14/h3-6,10,15-17H,2,7-9H2,1H3 |
| InChIKey | BZIONRVIQORDQX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |