C12H17NO — CID 70606554
2,3-diethyl-1H-indole;hydrate (PubChem CID 70606554) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 2,3-diethyl-1H-indole;hydrate.
| Compound Name | 2,3-diethyl-1H-indole;hydrate |
|---|---|
| PubChem CID | 70606554 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 2,3-diethyl-1H-indole;hydrate |
| SMILES | CCc1[nH]c2ccccc2c1CC.O |
| InChI | InChI=1S/C12H15N.H2O/c1-3-9-10-7-5-6-8-12(10)13-11(9)4-2;/h5-8,13H,3-4H2,1-2H3;1H2 |
| InChIKey | YHIGIZWIFQPCJC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|